C18H15F6N3O2 — CID 108529062
N'-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dimethylamino)phenyl]oxamide (PubChem CID 108529062) has the molecular formula C18H15F6N3O2 and a molecular weight of 419.33 g/mol. Its IUPAC name is N'-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dimethylamino)phenyl]oxamide.
| Compound Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dimethylamino)phenyl]oxamide |
|---|---|
| PubChem CID | 108529062 |
| Molecular Formula | C18H15F6N3O2 |
| Molecular Weight | 419.33 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-[3-(dimethylamino)phenyl]oxamide |
| SMILES | CN(C)c1cccc(NC(=O)C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H15F6N3O2/c1-27(2)14-5-3-4-12(9-14)25-15(28)16(29)26-13-7-10(17(19,20)21)6-11(8-13)18(22,23)24/h3-9H,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | FTDHDAOWVZKJPZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|