C17H11ClF6N2O2 — CID 108506154
N'-[3,5-bis(trifluoromethyl)phenyl]-N-[(2-chlorophenyl)methyl]oxamide (PubChem CID 108506154) has the molecular formula C17H11ClF6N2O2 and a molecular weight of 424.73 g/mol. Its IUPAC name is N'-[3,5-bis(trifluoromethyl)phenyl]-N-[(2-chlorophenyl)methyl]oxamide.
| Compound Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-[(2-chlorophenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108506154 |
| Molecular Formula | C17H11ClF6N2O2 |
| Molecular Weight | 424.73 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N'-[3,5-bis(trifluoromethyl)phenyl]-N-[(2-chlorophenyl)methyl]oxamide |
| SMILES | O=C(NCc1ccccc1Cl)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11ClF6N2O2/c18-13-4-2-1-3-9(13)8-25-14(27)15(28)26-12-6-10(16(19,20)21)5-11(7-12)17(22,23)24/h1-7H,8H2,(H,25,27)(H,26,28) |
| InChIKey | BXBSFRUMUGYDGF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|