C19H21F6N3O2S — CID 102307608
N-acetyl-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]cyclohexyl]acetamide (PubChem CID 102307608) has the molecular formula C19H21F6N3O2S and a molecular weight of 469.45 g/mol. Its IUPAC name is N-acetyl-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]cyclohexyl]acetamide.
| Compound Name | N-acetyl-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 102307608 |
| Molecular Formula | C19H21F6N3O2S |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-acetyl-N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]carbamothioylamino]cyclohexyl]acetamide |
| SMILES | CC(=O)N(C(C)=O)[C@@H]1CCCC[C@H]1NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F6N3O2S/c1-10(29)28(11(2)30)16-6-4-3-5-15(16)27-17(31)26-14-8-12(18(20,21)22)7-13(9-14)19(23,24)25/h7-9,15-16H,3-6H2,1-2H3,(H2,26,27,31)/t15-,16-/m1/s1 |
| InChIKey | SRKYJVQJZPJPDW-HZPDHXFCSA-N |
| XLogP | 4.72 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|