C25H27F6N3S — CID 166946274
1-[(1R,2R)-2-(dimethylamino)cyclohexyl]-3-[3-(trifluoromethyl)-5-[(E)-3-(2,3,6-trifluorophenyl)prop-2-enyl]phenyl]thiourea (PubChem CID 166946274) has the molecular formula C25H27F6N3S and a molecular weight of 515.57 g/mol. Its IUPAC name is 1-[(1R,2R)-2-(dimethylamino)cyclohexyl]-3-[3-(trifluoromethyl)-5-[(E)-3-(2,3,6-trifluorophenyl)prop-2-enyl]phenyl]thiourea.
| Compound Name | 1-[(1R,2R)-2-(dimethylamino)cyclohexyl]-3-[3-(trifluoromethyl)-5-[(E)-3-(2,3,6-trifluorophenyl)prop-2-enyl]phenyl]thiourea |
|---|---|
| PubChem CID | 166946274 |
| Molecular Formula | C25H27F6N3S |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 1-[(1R,2R)-2-(dimethylamino)cyclohexyl]-3-[3-(trifluoromethyl)-5-[(E)-3-(2,3,6-trifluorophenyl)prop-2-enyl]phenyl]thiourea |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1NC(=S)Nc1cc(C/C=C/c2c(F)ccc(F)c2F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H27F6N3S/c1-34(2)22-9-4-3-8-21(22)33-24(35)32-17-13-15(12-16(14-17)25(29,30)31)6-5-7-18-19(26)10-11-20(27)23(18)28/h5,7,10-14,21-22H,3-4,6,8-9H2,1-2H3,(H2,32,33,35)/b7-5+/t21-,22-/m1/s1 |
| InChIKey | FYMXZBJAUTVNPH-VICXPYPNSA-N |
| XLogP | 6.54 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|