C31H27F12N3S — CID 102154821
1-[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-3-[(1R,2R)-2-(dimethylamino)cyclohexyl]thiourea (PubChem CID 102154821) has the molecular formula C31H27F12N3S and a molecular weight of 701.62 g/mol. Its IUPAC name is 1-[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-3-[(1R,2R)-2-(dimethylamino)cyclohexyl]thiourea.
| Compound Name | 1-[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-3-[(1R,2R)-2-(dimethylamino)cyclohexyl]thiourea |
|---|---|
| PubChem CID | 102154821 |
| Molecular Formula | C31H27F12N3S |
| Molecular Weight | 701.62 g/mol |
| Exact Mass | 701.17 |
| IUPAC Name | 1-[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]-3-[(1R,2R)-2-(dimethylamino)cyclohexyl]thiourea |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1NC(=S)Nc1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C31H27F12N3S/c1-46(2)26-6-4-3-5-25(26)45-27(47)44-24-12-16(18-8-20(28(32,33)34)14-21(9-18)29(35,36)37)7-17(13-24)19-10-22(30(38,39)40)15-23(11-19)31(41,42)43/h7-15,25-26H,3-6H2,1-2H3,(H2,44,45,47)/t25-,26-/m1/s1 |
| InChIKey | DYTDRTALZWSSII-CLJLJLNGSA-N |
| XLogP | 10.26 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.62 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|