C17H24F3N3S — CID 132580566
1-[(1R,2R)-2-(dimethylamino)cyclohexyl]-3-[(1R)-2,2,2-trifluoro-1-phenylethyl]thiourea (PubChem CID 132580566) has the molecular formula C17H24F3N3S and a molecular weight of 359.46 g/mol. Its IUPAC name is 1-[(1R,2R)-2-(dimethylamino)cyclohexyl]-3-[(1R)-2,2,2-trifluoro-1-phenylethyl]thiourea.
| Compound Name | 1-[(1R,2R)-2-(dimethylamino)cyclohexyl]-3-[(1R)-2,2,2-trifluoro-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 132580566 |
| Molecular Formula | C17H24F3N3S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-[(1R,2R)-2-(dimethylamino)cyclohexyl]-3-[(1R)-2,2,2-trifluoro-1-phenylethyl]thiourea |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1NC(=S)N[C@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H24F3N3S/c1-23(2)14-11-7-6-10-13(14)21-16(24)22-15(17(18,19)20)12-8-4-3-5-9-12/h3-5,8-9,13-15H,6-7,10-11H2,1-2H3,(H2,21,22,24)/t13-,14-,15-/m1/s1 |
| InChIKey | VGSAJJXXGQLKJY-RBSFLKMASA-N |
| XLogP | 3.63 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|