C31H39N3S — CID 102167738
1,3-bis[(1S)-1-phenylethyl]-1-[(1S,2S)-2-[[(1S)-1-phenylethyl]amino]cyclohexyl]thiourea (PubChem CID 102167738) has the molecular formula C31H39N3S and a molecular weight of 485.74 g/mol. Its IUPAC name is 1,3-bis[(1S)-1-phenylethyl]-1-[(1S,2S)-2-[[(1S)-1-phenylethyl]amino]cyclohexyl]thiourea.
| Compound Name | 1,3-bis[(1S)-1-phenylethyl]-1-[(1S,2S)-2-[[(1S)-1-phenylethyl]amino]cyclohexyl]thiourea |
|---|---|
| PubChem CID | 102167738 |
| Molecular Formula | C31H39N3S |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 1,3-bis[(1S)-1-phenylethyl]-1-[(1S,2S)-2-[[(1S)-1-phenylethyl]amino]cyclohexyl]thiourea |
| SMILES | C[C@H](NC(=S)N([C@@H](C)c1ccccc1)[C@H]1CCCC[C@@H]1N[C@@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H39N3S/c1-23(26-15-7-4-8-16-26)32-29-21-13-14-22-30(29)34(25(3)28-19-11-6-12-20-28)31(35)33-24(2)27-17-9-5-10-18-27/h4-12,15-20,23-25,29-30,32H,13-14,21-22H2,1-3H3,(H,33,35)/t23-,24-,25-,29-,30-/m0/s1 |
| InChIKey | HKBFPGBBCFPAFM-XEBKLHOTSA-N |
| XLogP | 7.35 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|