C17H21F6N3OS — CID 87399458
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S,2S)-2-(dimethylamino)cyclohexyl]-1-sulfanylurea (PubChem CID 87399458) has the molecular formula C17H21F6N3OS and a molecular weight of 429.43 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S,2S)-2-(dimethylamino)cyclohexyl]-1-sulfanylurea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S,2S)-2-(dimethylamino)cyclohexyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87399458 |
| Molecular Formula | C17H21F6N3OS |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(1S,2S)-2-(dimethylamino)cyclohexyl]-1-sulfanylurea |
| SMILES | CN(C)[C@H]1CCCCC1NC(=O)N(S)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F6N3OS/c1-25(2)14-6-4-3-5-13(14)24-15(27)26(28)12-8-10(16(18,19)20)7-11(9-12)17(21,22)23/h7-9,13-14,28H,3-6H2,1-2H3,(H,24,27)/t13?,14-/m0/s1 |
| InChIKey | SEDOJLIQWXPCCF-KZUDCZAMSA-N |
| XLogP | 4.96 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|