C8H16N2O2 — CID 170429908
[(1R,2S)-2-(dimethylamino)cyclopentyl]carbamic acid (PubChem CID 170429908) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is [(1R,2S)-2-(dimethylamino)cyclopentyl]carbamic acid.
| Compound Name | [(1R,2S)-2-(dimethylamino)cyclopentyl]carbamic acid |
|---|---|
| PubChem CID | 170429908 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | [(1R,2S)-2-(dimethylamino)cyclopentyl]carbamic acid |
| SMILES | CN(C)[C@H]1CCC[C@H]1NC(=O)O |
| InChI | InChI=1S/C8H16N2O2/c1-10(2)7-5-3-4-6(7)9-8(11)12/h6-7,9H,3-5H2,1-2H3,(H,11,12)/t6-,7+/m1/s1 |
| InChIKey | QXUWRPLMXBIRQK-RQJHMYQMSA-N |
| XLogP | 0.74 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |