C21H39N5O2 — CID 167819747
4-(cyclohexylcarbamoylamino)-N-[2-(dimethylamino)cyclohexyl]piperidine-1-carboxamide (PubChem CID 167819747) has the molecular formula C21H39N5O2 and a molecular weight of 393.58 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[2-(dimethylamino)cyclohexyl]piperidine-1-carboxamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[2-(dimethylamino)cyclohexyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 167819747 |
| Molecular Formula | C21H39N5O2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.31 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[2-(dimethylamino)cyclohexyl]piperidine-1-carboxamide |
| SMILES | CN(C)C1CCCCC1NC(=O)N1CCC(NC(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C21H39N5O2/c1-25(2)19-11-7-6-10-18(19)24-21(28)26-14-12-17(13-15-26)23-20(27)22-16-8-4-3-5-9-16/h16-19H,3-15H2,1-2H3,(H,24,28)(H2,22,23,27) |
| InChIKey | KTQNFNGQHBELJH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |