C22H40N4O2 — CID 166321650
4-(cyclohexylcarbamoylamino)-N-[(2-ethylcyclohexyl)methyl]piperidine-1-carboxamide (PubChem CID 166321650) has the molecular formula C22H40N4O2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[(2-ethylcyclohexyl)methyl]piperidine-1-carboxamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[(2-ethylcyclohexyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 166321650 |
| Molecular Formula | C22H40N4O2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[(2-ethylcyclohexyl)methyl]piperidine-1-carboxamide |
| SMILES | CCC1CCCCC1CNC(=O)N1CCC(NC(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C22H40N4O2/c1-2-17-8-6-7-9-18(17)16-23-22(28)26-14-12-20(13-15-26)25-21(27)24-19-10-4-3-5-11-19/h17-20H,2-16H2,1H3,(H,23,28)(H2,24,25,27) |
| InChIKey | LOIYUTFTEJNSCZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |