C18H35ClN4O2 — CID 119750510
1-[1-(2-amino-2-methylpentanoyl)piperidin-4-yl]-3-cyclohexylurea;hydrochloride (PubChem CID 119750510) has the molecular formula C18H35ClN4O2 and a molecular weight of 374.96 g/mol. Its IUPAC name is 1-[1-(2-amino-2-methylpentanoyl)piperidin-4-yl]-3-cyclohexylurea;hydrochloride.
| Compound Name | 1-[1-(2-amino-2-methylpentanoyl)piperidin-4-yl]-3-cyclohexylurea;hydrochloride |
|---|---|
| PubChem CID | 119750510 |
| Molecular Formula | C18H35ClN4O2 |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1-[1-(2-amino-2-methylpentanoyl)piperidin-4-yl]-3-cyclohexylurea;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)N1CCC(NC(=O)NC2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C18H34N4O2.ClH/c1-3-11-18(2,19)16(23)22-12-9-15(10-13-22)21-17(24)20-14-7-5-4-6-8-14;/h14-15H,3-13,19H2,1-2H3,(H2,20,21,24);1H |
| InChIKey | YNGKXUDDIYWTTM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |