C18H29ClN2O — CID 119671917
2-amino-1-(4-benzylpiperidin-1-yl)-2-methylpentan-1-one;hydrochloride (PubChem CID 119671917) has the molecular formula C18H29ClN2O and a molecular weight of 324.90 g/mol. Its IUPAC name is 2-amino-1-(4-benzylpiperidin-1-yl)-2-methylpentan-1-one;hydrochloride.
| Compound Name | 2-amino-1-(4-benzylpiperidin-1-yl)-2-methylpentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119671917 |
| Molecular Formula | C18H29ClN2O |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 2-amino-1-(4-benzylpiperidin-1-yl)-2-methylpentan-1-one;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)N1CCC(Cc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C18H28N2O.ClH/c1-3-11-18(2,19)17(21)20-12-9-16(10-13-20)14-15-7-5-4-6-8-15;/h4-8,16H,3,9-14,19H2,1-2H3;1H |
| InChIKey | NYAQGOQFYPARLD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |