C25H32N2O2 — CID 108962285
N-benzyl-3-(4-benzylpiperidin-1-yl)-N,2,2-trimethyl-3-oxopropanamide (PubChem CID 108962285) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-benzyl-3-(4-benzylpiperidin-1-yl)-N,2,2-trimethyl-3-oxopropanamide.
| Compound Name | N-benzyl-3-(4-benzylpiperidin-1-yl)-N,2,2-trimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108962285 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N-benzyl-3-(4-benzylpiperidin-1-yl)-N,2,2-trimethyl-3-oxopropanamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(C)(C)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N2O2/c1-25(2,23(28)26(3)19-22-12-8-5-9-13-22)24(29)27-16-14-21(15-17-27)18-20-10-6-4-7-11-20/h4-13,21H,14-19H2,1-3H3 |
| InChIKey | CXEBVIUWFZSRGD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|