C10H20N2O2 — CID 96885494
2-[[(1S,2S)-2-(dimethylamino)cyclohexyl]amino]acetic acid (PubChem CID 96885494) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-(dimethylamino)cyclohexyl]amino]acetic acid.
| Compound Name | 2-[[(1S,2S)-2-(dimethylamino)cyclohexyl]amino]acetic acid |
|---|---|
| PubChem CID | 96885494 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2-[[(1S,2S)-2-(dimethylamino)cyclohexyl]amino]acetic acid |
| SMILES | CN(C)[C@H]1CCCC[C@@H]1NCC(=O)O |
| InChI | InChI=1S/C10H20N2O2/c1-12(2)9-6-4-3-5-8(9)11-7-10(13)14/h8-9,11H,3-7H2,1-2H3,(H,13,14)/t8-,9-/m0/s1 |
| InChIKey | SHIGPZCAFDAGJP-IUCAKERBSA-N |
| XLogP | 0.53 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |