2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid

C12H22N2O3 — CID 96555299

IUPAC2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid
SMILESCCN(C(C)=O)[C@@H]1CCCC[C@H]1NCC(=O)O
InChIInChI=1S/C12H22N2O3/c1-3-14(9(2)15)11-7-5-4-6-10(11)13-8-12(16)17/h10-11,13H,3-8H2,1-2H3,(H,16,17)/t10-,11-/m1/s1
InChIKeyQGBGOHLLWPTYND-GHMZBOCLSA-N
MW242.32 g/mol
LogP0.84
Rot. Bonds5

About 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid

2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid (PubChem CID 96555299) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid.

Molecular Properties

Compound Name2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid
PubChem CID96555299
Molecular FormulaC12H22N2O3
Molecular Weight242.32 g/mol
Exact Mass242.16
IUPAC Name2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid
SMILESCCN(C(C)=O)[C@@H]1CCCC[C@H]1NCC(=O)O
InChIInChI=1S/C12H22N2O3/c1-3-14(9(2)15)11-7-5-4-6-10(11)13-8-12(16)17/h10-11,13H,3-8H2,1-2H3,(H,16,17)/t10-,11-/m1/s1
InChIKeyQGBGOHLLWPTYND-GHMZBOCLSA-N
XLogP0.84
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.32
LogP ≤ 50.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid?
The IUPAC name of 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid (CID 96555299) is 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid.
What is the SMILES notation for 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid?
The canonical SMILES for 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid is CCN(C(C)=O)[C@@H]1CCCC[C@H]1NCC(=O)O.
What is the InChIKey of 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid?
The InChIKey is QGBGOHLLWPTYND-GHMZBOCLSA-N. The full InChI is InChI=1S/C12H22N2O3/c1-3-14(9(2)15)11-7-5-4-6-10(11)13-8-12(16)17/h10-11,13H,3-8H2,1-2H3,(H,16,17)/t10-,11-/m1/s1.
What are the key properties of 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid?
2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid has a molecular weight of 242.32 g/mol, XLogP of 0.84, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid is sourced from PubChem (CID 96555299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).