C12H22N2O3 — CID 96555299
2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid (PubChem CID 96555299) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid.
| Compound Name | 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid |
|---|---|
| PubChem CID | 96555299 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-[[(1R,2R)-2-[acetyl(ethyl)amino]cyclohexyl]amino]acetic acid |
| SMILES | CCN(C(C)=O)[C@@H]1CCCC[C@H]1NCC(=O)O |
| InChI | InChI=1S/C12H22N2O3/c1-3-14(9(2)15)11-7-5-4-6-10(11)13-8-12(16)17/h10-11,13H,3-8H2,1-2H3,(H,16,17)/t10-,11-/m1/s1 |
| InChIKey | QGBGOHLLWPTYND-GHMZBOCLSA-N |
| XLogP | 0.84 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |