C23H29F3N2O4S — CID 23349812
N-[2-(dimethylamino)cyclohexyl]-3-(trifluoromethyl)benzamide;4-methylbenzenesulfonic acid (PubChem CID 23349812) has the molecular formula C23H29F3N2O4S and a molecular weight of 486.56 g/mol. Its IUPAC name is N-[2-(dimethylamino)cyclohexyl]-3-(trifluoromethyl)benzamide;4-methylbenzenesulfonic acid.
| Compound Name | N-[2-(dimethylamino)cyclohexyl]-3-(trifluoromethyl)benzamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 23349812 |
| Molecular Formula | C23H29F3N2O4S |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N-[2-(dimethylamino)cyclohexyl]-3-(trifluoromethyl)benzamide;4-methylbenzenesulfonic acid |
| SMILES | CN(C)C1CCCCC1NC(=O)c1cccc(C(F)(F)F)c1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H21F3N2O.C7H8O3S/c1-21(2)14-9-4-3-8-13(14)20-15(22)11-6-5-7-12(10-11)16(17,18)19;1-6-2-4-7(5-3-6)11(8,9)10/h5-7,10,13-14H,3-4,8-9H2,1-2H3,(H,20,22);2-5H,1H3,(H,8,9,10) |
| InChIKey | KYIRBKCNKODOJR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|