C22H25F3N2O — CID 67186006
N-[4-[amino-(4-methylphenyl)methyl]cyclohexyl]-3-(trifluoromethyl)benzamide (PubChem CID 67186006) has the molecular formula C22H25F3N2O and a molecular weight of 390.45 g/mol. Its IUPAC name is N-[4-[amino-(4-methylphenyl)methyl]cyclohexyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[amino-(4-methylphenyl)methyl]cyclohexyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 67186006 |
| Molecular Formula | C22H25F3N2O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-[4-[amino-(4-methylphenyl)methyl]cyclohexyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(C(N)C2CCC(NC(=O)c3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C22H25F3N2O/c1-14-5-7-15(8-6-14)20(26)16-9-11-19(12-10-16)27-21(28)17-3-2-4-18(13-17)22(23,24)25/h2-8,13,16,19-20H,9-12,26H2,1H3,(H,27,28) |
| InChIKey | DSNTUIDHSLXOTQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |