C13H11F3N2O — CID 63822315
N-[cyano(cyclopropyl)methyl]-3-(trifluoromethyl)benzamide (PubChem CID 63822315) has the molecular formula C13H11F3N2O and a molecular weight of 268.24 g/mol. Its IUPAC name is N-[cyano(cyclopropyl)methyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[cyano(cyclopropyl)methyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 63822315 |
| Molecular Formula | C13H11F3N2O |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-[cyano(cyclopropyl)methyl]-3-(trifluoromethyl)benzamide |
| SMILES | N#CC(NC(=O)c1cccc(C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C13H11F3N2O/c14-13(15,16)10-3-1-2-9(6-10)12(19)18-11(7-17)8-4-5-8/h1-3,6,8,11H,4-5H2,(H,18,19) |
| InChIKey | BLNBMVQFEHARHZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |