C10H8Cl3F3N2O — CID 134118431
N-(1-amino-2,2,2-trichloroethyl)-3-(trifluoromethyl)benzamide (PubChem CID 134118431) has the molecular formula C10H8Cl3F3N2O and a molecular weight of 335.54 g/mol. Its IUPAC name is N-(1-amino-2,2,2-trichloroethyl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(1-amino-2,2,2-trichloroethyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 134118431 |
| Molecular Formula | C10H8Cl3F3N2O |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | N-(1-amino-2,2,2-trichloroethyl)-3-(trifluoromethyl)benzamide |
| SMILES | NC(NC(=O)c1cccc(C(F)(F)F)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H8Cl3F3N2O/c11-9(12,13)8(17)18-7(19)5-2-1-3-6(4-5)10(14,15)16/h1-4,8H,17H2,(H,18,19) |
| InChIKey | ZHJFIBMFPPEOGI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|