C21H26N2O3S — CID 9164435
N-[(1R,2S)-2-methylcyclohexyl]-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 9164435) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[(1R,2S)-2-methylcyclohexyl]-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(1R,2S)-2-methylcyclohexyl]-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 9164435 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[(1R,2S)-2-methylcyclohexyl]-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)N[C@@H]3CCCC[C@@H]3C)c2)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-15-10-12-18(13-11-15)23-27(25,26)19-8-5-7-17(14-19)21(24)22-20-9-4-3-6-16(20)2/h5,7-8,10-14,16,20,23H,3-4,6,9H2,1-2H3,(H,22,24)/t16-,20+/m0/s1 |
| InChIKey | IHXJFYDJQXAXPD-OXJNMPFZSA-N |
| XLogP | 4.10 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |