C17H8F12N2OS — CID 90939077
1,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-sulfanylurea (PubChem CID 90939077) has the molecular formula C17H8F12N2OS and a molecular weight of 516.31 g/mol. Its IUPAC name is 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-sulfanylurea.
| Compound Name | 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 90939077 |
| Molecular Formula | C17H8F12N2OS |
| Molecular Weight | 516.31 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | 1,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-sulfanylurea |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)N(S)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H8F12N2OS/c18-14(19,20)7-1-8(15(21,22)23)4-11(3-7)30-13(32)31(33)12-5-9(16(24,25)26)2-10(6-12)17(27,28)29/h1-6,33H,(H,30,32) |
| InChIKey | XORWXWLOGFKKMO-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.31 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|