C14H10ClF3N2O2S — CID 87656350
1-(5-chloro-2-hydroxyphenyl)-1-sulfanyl-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 87656350) has the molecular formula C14H10ClF3N2O2S and a molecular weight of 362.76 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)-1-sulfanyl-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)-1-sulfanyl-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 87656350 |
| Molecular Formula | C14H10ClF3N2O2S |
| Molecular Weight | 362.76 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)-1-sulfanyl-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N(S)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H10ClF3N2O2S/c15-9-3-6-12(21)11(7-9)20(23)13(22)19-10-4-1-8(2-5-10)14(16,17)18/h1-7,21,23H,(H,19,22) |
| InChIKey | DFUYBFJHFSLLDC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.76 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|