C14H9Cl2F3N2O2S — CID 87443599
1-(5-chloro-2-hydroxyphenyl)-3-[2-chloro-5-(trifluoromethyl)phenyl]-1-sulfanylurea (PubChem CID 87443599) has the molecular formula C14H9Cl2F3N2O2S and a molecular weight of 397.21 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)-3-[2-chloro-5-(trifluoromethyl)phenyl]-1-sulfanylurea.
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)-3-[2-chloro-5-(trifluoromethyl)phenyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87443599 |
| Molecular Formula | C14H9Cl2F3N2O2S |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)-3-[2-chloro-5-(trifluoromethyl)phenyl]-1-sulfanylurea |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)N(S)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C14H9Cl2F3N2O2S/c15-8-2-4-12(22)11(6-8)21(24)13(23)20-10-5-7(14(17,18)19)1-3-9(10)16/h1-6,22,24H,(H,20,23) |
| InChIKey | ONCSGEUFRMMJHR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|