C15H11Cl2F3N2O2S — CID 87655866
1-(3,5-dichloro-2-hydroxyphenyl)-1-sulfanyl-3-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 87655866) has the molecular formula C15H11Cl2F3N2O2S and a molecular weight of 411.23 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-hydroxyphenyl)-1-sulfanyl-3-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-(3,5-dichloro-2-hydroxyphenyl)-1-sulfanyl-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 87655866 |
| Molecular Formula | C15H11Cl2F3N2O2S |
| Molecular Weight | 411.23 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 1-(3,5-dichloro-2-hydroxyphenyl)-1-sulfanyl-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)N(S)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H11Cl2F3N2O2S/c16-10-5-11(17)13(23)12(6-10)22(25)14(24)21-7-8-1-3-9(4-2-8)15(18,19)20/h1-6,23,25H,7H2,(H,21,24) |
| InChIKey | UDVVTAZIUXLUHB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.23 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|