C16H10Cl2F6N2OS — CID 87616234
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2,4-dichlorophenyl)methyl]-1-sulfanylurea (PubChem CID 87616234) has the molecular formula C16H10Cl2F6N2OS and a molecular weight of 463.23 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2,4-dichlorophenyl)methyl]-1-sulfanylurea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2,4-dichlorophenyl)methyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87616234 |
| Molecular Formula | C16H10Cl2F6N2OS |
| Molecular Weight | 463.23 g/mol |
| Exact Mass | 461.98 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(2,4-dichlorophenyl)methyl]-1-sulfanylurea |
| SMILES | O=C(NCc1ccc(Cl)cc1Cl)N(S)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10Cl2F6N2OS/c17-11-2-1-8(13(18)6-11)7-25-14(27)26(28)12-4-9(15(19,20)21)3-10(5-12)16(22,23)24/h1-6,28H,7H2,(H,25,27) |
| InChIKey | BCCRQVIDKXGBQT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.23 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|