C12H13F3N2O3 — CID 62879277
2-[methyl-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]amino]acetic acid (PubChem CID 62879277) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 2-[methyl-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 62879277 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[methyl-[[4-(trifluoromethyl)phenyl]methylcarbamoyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O3/c1-17(7-10(18)19)11(20)16-6-8-2-4-9(5-3-8)12(13,14)15/h2-5H,6-7H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | GJWQKSFMGPVFJH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |