C16H21F3N2O3 — CID 122011310
3-[methyl-[[2-methyl-2-[4-(trifluoromethyl)phenyl]propyl]carbamoyl]amino]propanoic acid (PubChem CID 122011310) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is 3-[methyl-[[2-methyl-2-[4-(trifluoromethyl)phenyl]propyl]carbamoyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[[2-methyl-2-[4-(trifluoromethyl)phenyl]propyl]carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122011310 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-[methyl-[[2-methyl-2-[4-(trifluoromethyl)phenyl]propyl]carbamoyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)NCC(C)(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3N2O3/c1-15(2,10-20-14(24)21(3)9-8-13(22)23)11-4-6-12(7-5-11)16(17,18)19/h4-7H,8-10H2,1-3H3,(H,20,24)(H,22,23) |
| InChIKey | ISQXCXIQZJRDTG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |