C17H14F6N2OS — CID 87507304
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-methylphenyl)methyl]-1-sulfanylurea (PubChem CID 87507304) has the molecular formula C17H14F6N2OS and a molecular weight of 408.37 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-methylphenyl)methyl]-1-sulfanylurea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-methylphenyl)methyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 87507304 |
| Molecular Formula | C17H14F6N2OS |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-methylphenyl)methyl]-1-sulfanylurea |
| SMILES | Cc1ccc(CNC(=O)N(S)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H14F6N2OS/c1-10-2-4-11(5-3-10)9-24-15(26)25(27)14-7-12(16(18,19)20)6-13(8-14)17(21,22)23/h2-8,27H,9H2,1H3,(H,24,26) |
| InChIKey | PZUIZEZEVFKWEZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|