C27H26F6N2O2 — CID 122496223
4-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-[(4-methylphenyl)methylamino]ethyl]amino]methyl]benzoic acid (PubChem CID 122496223) has the molecular formula C27H26F6N2O2 and a molecular weight of 524.51 g/mol. Its IUPAC name is 4-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-[(4-methylphenyl)methylamino]ethyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-[(4-methylphenyl)methylamino]ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122496223 |
| Molecular Formula | C27H26F6N2O2 |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 4-[[[3,5-bis(trifluoromethyl)phenyl]methyl-[2-[(4-methylphenyl)methylamino]ethyl]amino]methyl]benzoic acid |
| SMILES | Cc1ccc(CNCCN(Cc2ccc(C(=O)O)cc2)Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C27H26F6N2O2/c1-18-2-4-19(5-3-18)15-34-10-11-35(16-20-6-8-22(9-7-20)25(36)37)17-21-12-23(26(28,29)30)14-24(13-21)27(31,32)33/h2-9,12-14,34H,10-11,15-17H2,1H3,(H,36,37) |
| InChIKey | PQVLGCRKAIPBLS-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|