C30H35F3N2O2 — CID 122495881
4-[[[3-methyl-5-(trifluoromethyl)phenyl]methyl-[3-[(4-propan-2-ylphenyl)methylamino]propyl]amino]methyl]benzoic acid (PubChem CID 122495881) has the molecular formula C30H35F3N2O2 and a molecular weight of 512.62 g/mol. Its IUPAC name is 4-[[[3-methyl-5-(trifluoromethyl)phenyl]methyl-[3-[(4-propan-2-ylphenyl)methylamino]propyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[3-methyl-5-(trifluoromethyl)phenyl]methyl-[3-[(4-propan-2-ylphenyl)methylamino]propyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122495881 |
| Molecular Formula | C30H35F3N2O2 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 4-[[[3-methyl-5-(trifluoromethyl)phenyl]methyl-[3-[(4-propan-2-ylphenyl)methylamino]propyl]amino]methyl]benzoic acid |
| SMILES | Cc1cc(CN(CCCNCc2ccc(C(C)C)cc2)Cc2ccc(C(=O)O)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H35F3N2O2/c1-21(2)26-9-5-23(6-10-26)18-34-13-4-14-35(19-24-7-11-27(12-8-24)29(36)37)20-25-15-22(3)16-28(17-25)30(31,32)33/h5-12,15-17,21,34H,4,13-14,18-20H2,1-3H3,(H,36,37) |
| InChIKey | RPBIMYJFRVGLLM-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|