C16H11F6NO2 — CID 175134386
4-[[3,5-bis(trifluoromethyl)phenyl]methylamino]benzoic acid (PubChem CID 175134386) has the molecular formula C16H11F6NO2 and a molecular weight of 363.26 g/mol. Its IUPAC name is 4-[[3,5-bis(trifluoromethyl)phenyl]methylamino]benzoic acid.
| Compound Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 175134386 |
| Molecular Formula | C16H11F6NO2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 4-[[3,5-bis(trifluoromethyl)phenyl]methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H11F6NO2/c17-15(18,19)11-5-9(6-12(7-11)16(20,21)22)8-23-13-3-1-10(2-4-13)14(24)25/h1-7,23H,8H2,(H,24,25) |
| InChIKey | FAIQNOCVEZXPPT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |