C30H18F18N6 — CID 162538922
2-N,4-N,6-N-tris[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 162538922) has the molecular formula C30H18F18N6 and a molecular weight of 804.48 g/mol. Its IUPAC name is 2-N,4-N,6-N-tris[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tris[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 162538922 |
| Molecular Formula | C30H18F18N6 |
| Molecular Weight | 804.48 g/mol |
| Exact Mass | 804.13 |
| IUPAC Name | 2-N,4-N,6-N-tris[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | FC(F)(F)c1cc(CNc2nc(NCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)nc(NCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H18F18N6/c31-25(32,33)16-1-13(2-17(7-16)26(34,35)36)10-49-22-52-23(50-11-14-3-18(27(37,38)39)8-19(4-14)28(40,41)42)54-24(53-22)51-12-15-5-20(29(43,44)45)9-21(6-15)30(46,47)48/h1-9H,10-12H2,(H3,49,50,51,52,53,54) |
| InChIKey | SAXFTXWZBZELSG-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.48 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |