C10H11F5NP — CID 142152838
1-[3-[difluoro(phosphanyl)methyl]-5-(trifluoromethyl)phenyl]-N-methylmethanamine (PubChem CID 142152838) has the molecular formula C10H11F5NP and a molecular weight of 271.17 g/mol. Its IUPAC name is 1-[3-[difluoro(phosphanyl)methyl]-5-(trifluoromethyl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3-[difluoro(phosphanyl)methyl]-5-(trifluoromethyl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 142152838 |
| Molecular Formula | C10H11F5NP |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 1-[3-[difluoro(phosphanyl)methyl]-5-(trifluoromethyl)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(C(F)(F)F)cc(C(F)(F)P)c1 |
| InChI | InChI=1S/C10H11F5NP/c1-16-5-6-2-7(9(11,12)13)4-8(3-6)10(14,15)17/h2-4,16H,5,17H2,1H3 |
| InChIKey | XBLLCDWKSDRFDJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|