C24H14F12N2O2 — CID 130476118
2,5-bis[[3,5-bis(trifluoromethyl)phenyl]methylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 130476118) has the molecular formula C24H14F12N2O2 and a molecular weight of 590.36 g/mol. Its IUPAC name is 2,5-bis[[3,5-bis(trifluoromethyl)phenyl]methylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[[3,5-bis(trifluoromethyl)phenyl]methylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 130476118 |
| Molecular Formula | C24H14F12N2O2 |
| Molecular Weight | 590.36 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | 2,5-bis[[3,5-bis(trifluoromethyl)phenyl]methylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C(=O)C=C1NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H14F12N2O2/c25-21(26,27)13-1-11(2-14(5-13)22(28,29)30)9-37-17-7-20(40)18(8-19(17)39)38-10-12-3-15(23(31,32)33)6-16(4-12)24(34,35)36/h1-8,37-38H,9-10H2 |
| InChIKey | UWGPLBZPXNYSCT-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.36 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|