C13H12F6N4 — CID 167943879
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-ethyltriazol-4-amine (PubChem CID 167943879) has the molecular formula C13H12F6N4 and a molecular weight of 338.26 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-ethyltriazol-4-amine.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-ethyltriazol-4-amine |
|---|---|
| PubChem CID | 167943879 |
| Molecular Formula | C13H12F6N4 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-ethyltriazol-4-amine |
| SMILES | CCn1cc(NCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C13H12F6N4/c1-2-23-7-11(21-22-23)20-6-8-3-9(12(14,15)16)5-10(4-8)13(17,18)19/h3-5,7,20H,2,6H2,1H3 |
| InChIKey | XKAFUWRSYOFCRC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |