C14H18F3N5O — CID 167839387
N-[[4-(dimethylamino)-2-(trifluoromethyl)phenyl]methyl]-1-(methoxymethyl)triazol-4-amine (PubChem CID 167839387) has the molecular formula C14H18F3N5O and a molecular weight of 329.33 g/mol. Its IUPAC name is N-[[4-(dimethylamino)-2-(trifluoromethyl)phenyl]methyl]-1-(methoxymethyl)triazol-4-amine.
| Compound Name | N-[[4-(dimethylamino)-2-(trifluoromethyl)phenyl]methyl]-1-(methoxymethyl)triazol-4-amine |
|---|---|
| PubChem CID | 167839387 |
| Molecular Formula | C14H18F3N5O |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-[[4-(dimethylamino)-2-(trifluoromethyl)phenyl]methyl]-1-(methoxymethyl)triazol-4-amine |
| SMILES | COCn1cc(NCc2ccc(N(C)C)cc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C14H18F3N5O/c1-21(2)11-5-4-10(12(6-11)14(15,16)17)7-18-13-8-22(9-23-3)20-19-13/h4-6,8,18H,7,9H2,1-3H3 |
| InChIKey | MRNFSDHSESUEKZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |