C16H14F4N2O2 — CID 60505506
ethyl 6-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]pyridine-3-carboxylate (PubChem CID 60505506) has the molecular formula C16H14F4N2O2 and a molecular weight of 342.29 g/mol. Its IUPAC name is ethyl 6-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 60505506 |
| Molecular Formula | C16H14F4N2O2 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | ethyl 6-[[4-fluoro-2-(trifluoromethyl)phenyl]methylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCc2ccc(F)cc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H14F4N2O2/c1-2-24-15(23)11-4-6-14(22-9-11)21-8-10-3-5-12(17)7-13(10)16(18,19)20/h3-7,9H,2,8H2,1H3,(H,21,22) |
| InChIKey | ITAMJBDTZIIDAD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |