C12H13N3O3 — CID 79492611
ethyl 6-(1,2-oxazol-3-ylmethylamino)pyridine-3-carboxylate (PubChem CID 79492611) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl 6-(1,2-oxazol-3-ylmethylamino)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(1,2-oxazol-3-ylmethylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 79492611 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | ethyl 6-(1,2-oxazol-3-ylmethylamino)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCc2ccon2)nc1 |
| InChI | InChI=1S/C12H13N3O3/c1-2-17-12(16)9-3-4-11(13-7-9)14-8-10-5-6-18-15-10/h3-7H,2,8H2,1H3,(H,13,14) |
| InChIKey | SYMYBPHZNGBZIT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |