C16H15BrF3N — CID 107082606
4-(bromomethyl)-N-methyl-N-(4-methylphenyl)-3-(trifluoromethyl)aniline (PubChem CID 107082606) has the molecular formula C16H15BrF3N and a molecular weight of 358.20 g/mol. Its IUPAC name is 4-(bromomethyl)-N-methyl-N-(4-methylphenyl)-3-(trifluoromethyl)aniline.
| Compound Name | 4-(bromomethyl)-N-methyl-N-(4-methylphenyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107082606 |
| Molecular Formula | C16H15BrF3N |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 4-(bromomethyl)-N-methyl-N-(4-methylphenyl)-3-(trifluoromethyl)aniline |
| SMILES | Cc1ccc(N(C)c2ccc(CBr)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H15BrF3N/c1-11-3-6-13(7-4-11)21(2)14-8-5-12(10-17)15(9-14)16(18,19)20/h3-9H,10H2,1-2H3 |
| InChIKey | GXDAKLFXPGMFLF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|