C12H8F6N2O — CID 87974393
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-cyanoacetamide (PubChem CID 87974393) has the molecular formula C12H8F6N2O and a molecular weight of 310.20 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-cyanoacetamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-cyanoacetamide |
|---|---|
| PubChem CID | 87974393 |
| Molecular Formula | C12H8F6N2O |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-cyanoacetamide |
| SMILES | N#CCC(=O)NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H8F6N2O/c13-11(14,15)8-3-7(6-20-10(21)1-2-19)4-9(5-8)12(16,17)18/h3-5H,1,6H2,(H,20,21) |
| InChIKey | VLUMRMFVBOGABG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |