C15H6F11NO2S — CID 3862785
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide (PubChem CID 3862785) has the molecular formula C15H6F11NO2S and a molecular weight of 473.26 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3862785 |
| Molecular Formula | C15H6F11NO2S |
| Molecular Weight | 473.26 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H6F11NO2S/c16-8-9(17)11(19)13(12(20)10(8)18)30(28,29)27-4-5-1-6(14(21,22)23)3-7(2-5)15(24,25)26/h1-3,27H,4H2 |
| InChIKey | LDHXMTZXRXJVLK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.26 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|