C13H8BrClF4N2O2S — CID 3535479
5-bromo-6-chloro-N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyridine-3-sulfonamide (PubChem CID 3535479) has the molecular formula C13H8BrClF4N2O2S and a molecular weight of 447.64 g/mol. Its IUPAC name is 5-bromo-6-chloro-N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-6-chloro-N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 3535479 |
| Molecular Formula | C13H8BrClF4N2O2S |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 445.91 |
| IUPAC Name | 5-bromo-6-chloro-N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCc1cc(F)cc(C(F)(F)F)c1)c1cnc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H8BrClF4N2O2S/c14-11-4-10(6-20-12(11)15)24(22,23)21-5-7-1-8(13(17,18)19)3-9(16)2-7/h1-4,6,21H,5H2 |
| InChIKey | DFOFYGGWKLCLNN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|