C14H10Br2F3NO2S — CID 98000782
3-bromo-N-[(4-bromophenyl)methyl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 98000782) has the molecular formula C14H10Br2F3NO2S and a molecular weight of 473.11 g/mol. Its IUPAC name is 3-bromo-N-[(4-bromophenyl)methyl]-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 3-bromo-N-[(4-bromophenyl)methyl]-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 98000782 |
| Molecular Formula | C14H10Br2F3NO2S |
| Molecular Weight | 473.11 g/mol |
| Exact Mass | 470.88 |
| IUPAC Name | 3-bromo-N-[(4-bromophenyl)methyl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1ccc(Br)cc1)c1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10Br2F3NO2S/c15-11-3-1-9(2-4-11)8-20-23(21,22)13-6-10(14(17,18)19)5-12(16)7-13/h1-7,20H,8H2 |
| InChIKey | YEJNJEANQQNXGX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.11 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |