C15H8F9NO2S — CID 3471758
3,5-bis(trifluoromethyl)-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide (PubChem CID 3471758) has the molecular formula C15H8F9NO2S and a molecular weight of 437.28 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide.
| Compound Name | 3,5-bis(trifluoromethyl)-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3471758 |
| Molecular Formula | C15H8F9NO2S |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 3,5-bis(trifluoromethyl)-N-[(3,4,5-trifluorophenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(F)c(F)c(F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H8F9NO2S/c16-11-1-7(2-12(17)13(11)18)6-25-28(26,27)10-4-8(14(19,20)21)3-9(5-10)15(22,23)24/h1-5,25H,6H2 |
| InChIKey | SVKYFOOICCVVHA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|