C13H9F6NO2S2 — CID 3271736
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]thiophene-2-sulfonamide (PubChem CID 3271736) has the molecular formula C13H9F6NO2S2 and a molecular weight of 389.34 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3271736 |
| Molecular Formula | C13H9F6NO2S2 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cccs1 |
| InChI | InChI=1S/C13H9F6NO2S2/c14-12(15,16)9-4-8(5-10(6-9)13(17,18)19)7-20-24(21,22)11-2-1-3-23-11/h1-6,20H,7H2 |
| InChIKey | RWMFMTPYUGFPJB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |