C11H8F3NO2S2 — CID 3807214
N-[(3,4,5-trifluorophenyl)methyl]thiophene-2-sulfonamide (PubChem CID 3807214) has the molecular formula C11H8F3NO2S2 and a molecular weight of 307.32 g/mol. Its IUPAC name is N-[(3,4,5-trifluorophenyl)methyl]thiophene-2-sulfonamide.
| Compound Name | N-[(3,4,5-trifluorophenyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 3807214 |
| Molecular Formula | C11H8F3NO2S2 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | N-[(3,4,5-trifluorophenyl)methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1cc(F)c(F)c(F)c1)c1cccs1 |
| InChI | InChI=1S/C11H8F3NO2S2/c12-8-4-7(5-9(13)11(8)14)6-15-19(16,17)10-2-1-3-18-10/h1-5,15H,6H2 |
| InChIKey | YNNHXJATPXLOGI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|