C12H12FN3O3S2 — CID 76995429
3-fluoro-N'-hydroxy-4-[(thiophen-2-ylsulfonylamino)methyl]benzenecarboximidamide (PubChem CID 76995429) has the molecular formula C12H12FN3O3S2 and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-[(thiophen-2-ylsulfonylamino)methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-N'-hydroxy-4-[(thiophen-2-ylsulfonylamino)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 76995429 |
| Molecular Formula | C12H12FN3O3S2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-[(thiophen-2-ylsulfonylamino)methyl]benzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(CNS(=O)(=O)c2cccs2)c(F)c1 |
| InChI | InChI=1S/C12H12FN3O3S2/c13-10-6-8(12(14)16-17)3-4-9(10)7-15-21(18,19)11-2-1-5-20-11/h1-6,15,17H,7H2,(H2,14,16) |
| InChIKey | RKHNCUUMUAVEEZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|