C8H9FN2O2 — CID 50941129
3-fluoro-N'-hydroxy-4-(hydroxymethyl)benzenecarboximidamide (PubChem CID 50941129) has the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-(hydroxymethyl)benzenecarboximidamide.
| Compound Name | 3-fluoro-N'-hydroxy-4-(hydroxymethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 50941129 |
| Molecular Formula | C8H9FN2O2 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-(hydroxymethyl)benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(CO)c(F)c1 |
| InChI | InChI=1S/C8H9FN2O2/c9-7-3-5(8(10)11-13)1-2-6(7)4-12/h1-3,12-13H,4H2,(H2,10,11) |
| InChIKey | XJFYMSCMHWLIEE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|