C7H7FN2O2 — CID 135741555
3-fluoro-N',4-dihydroxybenzenecarboximidamide (PubChem CID 135741555) has the molecular formula C7H7FN2O2 and a molecular weight of 170.14 g/mol. Its IUPAC name is 3-fluoro-N',4-dihydroxybenzenecarboximidamide.
| Compound Name | 3-fluoro-N',4-dihydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 135741555 |
| Molecular Formula | C7H7FN2O2 |
| Molecular Weight | 170.14 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 3-fluoro-N',4-dihydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C7H7FN2O2/c8-5-3-4(7(9)10-12)1-2-6(5)11/h1-3,11-12H,(H2,9,10) |
| InChIKey | IRXKMKHROUUOLJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.14 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|